Difference between revisions of "LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13700 == * common-name: ** 3-oxo-4-pregnene-20-carboxyl-coa * smiles: ** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op...")
(Created page with "Category:metabolite == Metabolite CPD-7417 == * common-name: ** cis-coumarinic acid-β-d-glucoside * smiles: ** c(c2(oc(oc1(c=cc=cc=1c=cc(=o)[o-]))c(c(c2o)o)o))o * inc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-13700 ==
+
== Metabolite CPD-7417 ==
 
* common-name:
 
* common-name:
−
** 3-oxo-4-pregnene-20-carboxyl-coa
+
** cis-coumarinic acid-β-d-glucoside
 
* smiles:
 
* smiles:
−
** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])[ch]6(cc[ch]7([ch]5(ccc4(=cc(=o)ccc(c)4[ch]5ccc(c)67))))
+
** c(c2(oc(oc1(c=cc=cc=1c=cc(=o)[o-]))c(c(c2o)o)o))o
 
* inchi-key:
 
* inchi-key:
−
** cjjbducnumwujx-zktjokcmsa-j
+
** gvriyimnjgulcz-qlfwqtqqsa-m
 
* molecular-weight:
 
* molecular-weight:
−
** 1089.98
+
** 325.294
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-8036]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-12710]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=3-oxo-4-pregnene-20-carboxyl-coa}}
+
{{#set: common-name=cis-coumarinic acid-β-d-glucoside}}
−
{{#set: inchi-key=inchikey=cjjbducnumwujx-zktjokcmsa-j}}
+
{{#set: inchi-key=inchikey=gvriyimnjgulcz-qlfwqtqqsa-m}}
−
{{#set: molecular-weight=1089.98}}
+
{{#set: molecular-weight=325.294}}

Revision as of 13:11, 14 January 2021

Metabolite CPD-7417

  • common-name:
    • cis-coumarinic acid-β-d-glucoside
  • smiles:
    • c(c2(oc(oc1(c=cc=cc=1c=cc(=o)[o-]))c(c(c2o)o)o))o
  • inchi-key:
    • gvriyimnjgulcz-qlfwqtqqsa-m
  • molecular-weight:
    • 325.294

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE&oldid=86656"