Difference between revisions of "CPD-11712"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7279 == * common-name: ** 2-cis,4-trans-xanthoxin * smiles: ** cc(c=cc12(c(cc(cc1(c)o2)o)(c)c))=cc=o * inchi-key: ** ztalkmxohwqnia-t...")
(Created page with "Category:metabolite == Metabolite SQUALENE == * common-name: ** squalene * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc=c(c)ccc=c(c)ccc=c(c)c * inchi-key: ** yygntywphwgjrm-aajyl...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7279 ==
+
== Metabolite SQUALENE ==
 
* common-name:
 
* common-name:
** 2-cis,4-trans-xanthoxin
+
** squalene
 
* smiles:
 
* smiles:
** cc(c=cc12(c(cc(cc1(c)o2)o)(c)c))=cc=o
+
** cc(c)=cccc(c)=cccc(c)=cccc=c(c)ccc=c(c)ccc=c(c)c
 
* inchi-key:
 
* inchi-key:
** ztalkmxohwqnia-tvbshjcbsa-n
+
** yygntywphwgjrm-aajylucbsa-n
 
* molecular-weight:
 
* molecular-weight:
** 250.337
+
** 410.725
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.1.1.288-RXN]]
+
* [[SMO]]
 +
* [[SQUALENE-MONOOXYGENASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-698]]
+
* [[RXN-13162]]
* [[RXN-7973-CPD-7424/OXYGEN-MOLECULE//CPD-7279/CPD-7280.44.]]
+
* [[RXN-13724]]
 +
* [[RXN66-281]]
 +
* [[SMO]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-cis,4-trans-xanthoxin}}
+
{{#set: common-name=squalene}}
{{#set: inchi-key=inchikey=ztalkmxohwqnia-tvbshjcbsa-n}}
+
{{#set: inchi-key=inchikey=yygntywphwgjrm-aajylucbsa-n}}
{{#set: molecular-weight=250.337}}
+
{{#set: molecular-weight=410.725}}

Revision as of 13:11, 14 January 2021

Metabolite SQUALENE

  • common-name:
    • squalene
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc=c(c)ccc=c(c)ccc=c(c)c
  • inchi-key:
    • yygntywphwgjrm-aajylucbsa-n
  • molecular-weight:
    • 410.725

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality