Difference between revisions of "2-HYDROXYPHYTANOYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GLC-D-LACTONE == * common-name: ** d-glucono-1,5-lactone * smiles: ** c(o)c1(oc(c(c(c1o)o)o)=o) * inchi-key: ** phoqvhqstubqqk-sqougzdysa...") |
(Created page with "Category:metabolite == Metabolite LIPOIC-ACID == * common-name: ** (r)-lipoate * smiles: ** c(ccc(=o)[o-])cc1(ccss1) * inchi-key: ** agbqknbqesqnjd-ssdottswsa-m * molecula...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite LIPOIC-ACID == |
* common-name: | * common-name: | ||
| − | ** | + | ** (r)-lipoate |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(ccc(=o)[o-])cc1(ccss1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** agbqknbqesqnjd-ssdottswsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 205.309 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-17127]] |
| + | * [[RXN-8654]] | ||
| + | * [[RXN0-1141]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(r)-lipoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=agbqknbqesqnjd-ssdottswsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=205.309}} |
Revision as of 13:11, 14 January 2021
Contents
Metabolite LIPOIC-ACID
- common-name:
- (r)-lipoate
- smiles:
- c(ccc(=o)[o-])cc1(ccss1)
- inchi-key:
- agbqknbqesqnjd-ssdottswsa-m
- molecular-weight:
- 205.309
