Difference between revisions of "GLUTAMATE-1-SEMIALDEHYDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite UBIQUINONE-8 == * common-name: ** ubiquinone-8 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c(oc)=c(...")
(Created page with "Category:metabolite == Metabolite CPD-19065 == * common-name: ** 1,1-dihydroxypropan-2-one * smiles: ** cc(=o)c(o)o * inchi-key: ** uoqfzgvggmhgee-uhfffaoysa-n * molecular...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite UBIQUINONE-8 ==
+
== Metabolite CPD-19065 ==
 
* common-name:
 
* common-name:
** ubiquinone-8
+
** 1,1-dihydroxypropan-2-one
 
* smiles:
 
* smiles:
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c(oc)=c(oc)c(=o)c(c)=1)=o)
+
** cc(=o)c(o)o
 
* inchi-key:
 
* inchi-key:
** icfizjqgjajrsu-sghxuwjisa-n
+
** uoqfzgvggmhgee-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 727.121
+
** 90.079
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[R00281]]
 
* [[SUCDH_LPAREN_q8_RPAREN_m]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[R00281]]
+
* [[RXN-17625]]
* [[SUCDH_LPAREN_q8_RPAREN_m]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=ubiquinone-8}}
+
{{#set: common-name=1,1-dihydroxypropan-2-one}}
{{#set: inchi-key=inchikey=icfizjqgjajrsu-sghxuwjisa-n}}
+
{{#set: inchi-key=inchikey=uoqfzgvggmhgee-uhfffaoysa-n}}
{{#set: molecular-weight=727.121}}
+
{{#set: molecular-weight=90.079}}

Revision as of 13:12, 14 January 2021

Metabolite CPD-19065

  • common-name:
    • 1,1-dihydroxypropan-2-one
  • smiles:
    • cc(=o)c(o)o
  • inchi-key:
    • uoqfzgvggmhgee-uhfffaoysa-n
  • molecular-weight:
    • 90.079

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality