Difference between revisions of "CPD-661"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Ubiquitin-C-Terminal-Glycine == * common-name: ** a [ubiquitin] c-terminal glycine == Reaction(s) known to consume the compound == * UB...")
(Created page with "Category:metabolite == Metabolite CPD-730 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate * smiles: ** ccc=ccc1(c(ccc(=o)1)cccccccc([o-])=o) * inch...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Ubiquitin-C-Terminal-Glycine ==
+
== Metabolite CPD-730 ==
 
* common-name:
 
* common-name:
** a [ubiquitin] c-terminal glycine
+
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate
 +
* smiles:
 +
** ccc=ccc1(c(ccc(=o)1)cccccccc([o-])=o)
 +
* inchi-key:
 +
** bzxzfdkirzbjep-jmtmcxqrsa-m
 +
* molecular-weight:
 +
** 293.425
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.4.19.12-RXN]]
+
* [[12-OXOPHYTODIENOATE-REDUCTASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [ubiquitin] c-terminal glycine}}
+
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate}}
 +
{{#set: inchi-key=inchikey=bzxzfdkirzbjep-jmtmcxqrsa-m}}
 +
{{#set: molecular-weight=293.425}}

Revision as of 13:12, 14 January 2021

Metabolite CPD-730

  • common-name:
    • 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate
  • smiles:
    • ccc=ccc1(c(ccc(=o)1)cccccccc([o-])=o)
  • inchi-key:
    • bzxzfdkirzbjep-jmtmcxqrsa-m
  • molecular-weight:
    • 293.425

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality