Difference between revisions of "GlcNAc-GlcA-GlcNAc-GlcA-Gal-Gal-Xyl-Core"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite D-TRYPTOPHAN == * common-name: ** d-tryptophan * smiles: ** c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2)) * inchi-key: ** qivbcdijiajpqs-secbi...") |
(Created page with "Category:metabolite == Metabolite N-FORMYLKYNURENINE == * common-name: ** n-formylkynurenine * smiles: ** [ch](=o)nc1(c=cc=cc=1c(=o)cc([n+])c(=o)[o-]) * inchi-key: ** byhj...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite N-FORMYLKYNURENINE == |
* common-name: | * common-name: | ||
− | ** | + | ** n-formylkynurenine |
* smiles: | * smiles: | ||
− | ** | + | ** [ch](=o)nc1(c=cc=cc=1c(=o)cc([n+])c(=o)[o-]) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** byhjhxptqmmkca-qmmmgpobsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 236.227 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[ARYLFORMAMIDASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-8665]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=n-formylkynurenine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=byhjhxptqmmkca-qmmmgpobsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=236.227}} |
Revision as of 13:12, 14 January 2021
Contents
Metabolite N-FORMYLKYNURENINE
- common-name:
- n-formylkynurenine
- smiles:
- [ch](=o)nc1(c=cc=cc=1c(=o)cc([n+])c(=o)[o-])
- inchi-key:
- byhjhxptqmmkca-qmmmgpobsa-n
- molecular-weight:
- 236.227