Difference between revisions of "CDP-2-3-4-Saturated-Diacylglycerols"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8161 == * common-name: ** 1-18:2-2-16:0-digalactosyldiacylglycerol * smiles: ** cccccc=ccc=ccccccccc(=o)occ(coc2(oc(coc1(oc(co)c(o)c(...") |
(Created page with "Category:metabolite == Metabolite BETA-D-GALACTOSYL-ETCETERA-GLUCOSAMINE == * common-name: ** β-d-galactosyl-(1→4)-n-acetyl-d-glucosamine * smiles: ** cc(=o)nc2(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite BETA-D-GALACTOSYL-ETCETERA-GLUCOSAMINE == |
* common-name: | * common-name: | ||
| − | ** 1- | + | ** β-d-galactosyl-(1→4)-n-acetyl-d-glucosamine |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(=o)nc2(c(o)oc(co)c(oc1(oc(co)c(o)c(o)c(o)1))c(o)2) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** kfeujdwyngmdbv-rphkzzmbsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 383.352 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-15268]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[N-ACETYLLACTOSAMINE-SYNTHASE-RXN]] | ||
| + | * [[RXN-15268]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=1- | + | {{#set: common-name=β-d-galactosyl-(1→4)-n-acetyl-d-glucosamine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=kfeujdwyngmdbv-rphkzzmbsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=383.352}} |
Revision as of 13:12, 14 January 2021
Contents
Metabolite BETA-D-GALACTOSYL-ETCETERA-GLUCOSAMINE
- common-name:
- β-d-galactosyl-(1→4)-n-acetyl-d-glucosamine
- smiles:
- cc(=o)nc2(c(o)oc(co)c(oc1(oc(co)c(o)c(o)c(o)1))c(o)2)
- inchi-key:
- kfeujdwyngmdbv-rphkzzmbsa-n
- molecular-weight:
- 383.352
