Difference between revisions of "Protein-N-acetyl-D-glucosamine-L-thr"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PRISTANATE == * common-name: ** pristanate * smiles: ** cc(cccc(cccc(c)cccc(c([o-])=o)c)c)c * inchi-key: ** pahgjzdqxioyth-uhfffaoysa-m *...") |
(Created page with "Category:metabolite == Metabolite Monocarboxylates == * common-name: ** a monocarboxylate == Reaction(s) known to consume the compound == == Reaction(s) known to produce t...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Monocarboxylates == |
* common-name: | * common-name: | ||
− | ** | + | ** a monocarboxylate |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[AMIDASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a monocarboxylate}} |
− | |||
− |
Revision as of 13:12, 14 January 2021
Contents
Metabolite Monocarboxylates
- common-name:
- a monocarboxylate