Difference between revisions of "Protein-N-acetyl-D-glucosamine-L-thr"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PRISTANATE == * common-name: ** pristanate * smiles: ** cc(cccc(cccc(c)cccc(c([o-])=o)c)c)c * inchi-key: ** pahgjzdqxioyth-uhfffaoysa-m *...")
(Created page with "Category:metabolite == Metabolite Monocarboxylates == * common-name: ** a monocarboxylate == Reaction(s) known to consume the compound == == Reaction(s) known to produce t...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PRISTANATE ==
+
== Metabolite Monocarboxylates ==
 
* common-name:
 
* common-name:
** pristanate
+
** a monocarboxylate
* smiles:
 
** cc(cccc(cccc(c)cccc(c([o-])=o)c)c)c
 
* inchi-key:
 
** pahgjzdqxioyth-uhfffaoysa-m
 
* molecular-weight:
 
** 297.5
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-484]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[AMIDASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pristanate}}
+
{{#set: common-name=a monocarboxylate}}
{{#set: inchi-key=inchikey=pahgjzdqxioyth-uhfffaoysa-m}}
 
{{#set: molecular-weight=297.5}}
 

Revision as of 13:12, 14 January 2021

Metabolite Monocarboxylates

  • common-name:
    • a monocarboxylate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality