Difference between revisions of "Trans-3-enoyl-CoAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19492 == * common-name: ** 3-ethyl-2-oxosuccinate * smiles: ** ccc(c([o-])=o)c(c(=o)[o-])=o * inchi-key: ** ouglpihdpbrsid-uhfffaoysa...") |
(Created page with "Category:metabolite == Metabolite CPD0-971 == * common-name: ** an α-limit dextrin == Reaction(s) known to consume the compound == == Reaction(s) known to produce th...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD0-971 == |
* common-name: | * common-name: | ||
− | ** | + | ** an α-limit dextrin |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[GLYCOPHOSPHORYL-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an α-limit dextrin}} |
− | |||
− |
Revision as of 13:12, 14 January 2021
Contents
Metabolite CPD0-971
- common-name:
- an α-limit dextrin