Difference between revisions of "DIPEPTIDES"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite MALTOTRIOSE == * common-name: ** maltotriose * smiles: ** c(c1(oc(c(c(c1o)o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co)))o * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite DOLICHOLP == * common-name: ** a dolichyl phosphate == Reaction(s) known to consume the compound == * 2.4.1.117-RXN * [[2.4.1.83-RXN]...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite DOLICHOLP == |
* common-name: | * common-name: | ||
− | ** | + | ** a dolichyl phosphate |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[2.4.1.117-RXN]] |
+ | * [[2.4.1.83-RXN]] | ||
+ | * [[2.7.8.15-RXN]] | ||
+ | * [[DOLICHYLDIPHOSPHATASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[2.4.1.109-RXN]] |
+ | * [[DOLICHOL-KINASE-RXN]] | ||
+ | * [[DOLICHYLDIPHOSPHATASE-RXN]] | ||
+ | * [[RXN-5466]] | ||
+ | * [[RXN-5467]] | ||
+ | * [[RXN-5468]] | ||
+ | * [[RXN-5469]] | ||
+ | * [[RXN-5470]] | ||
+ | * [[RXN-5471]] | ||
+ | * [[RXN-5472]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a dolichyl phosphate}} |
− | |||
− |
Revision as of 13:12, 14 January 2021
Contents
Metabolite DOLICHOLP
- common-name:
- a dolichyl phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
- 2.4.1.109-RXN
- DOLICHOL-KINASE-RXN
- DOLICHYLDIPHOSPHATASE-RXN
- RXN-5466
- RXN-5467
- RXN-5468
- RXN-5469
- RXN-5470
- RXN-5471
- RXN-5472