Difference between revisions of "25S-rRNA-adenine-2142"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite FMN == * common-name: ** fmn * smiles: ** cc2(=cc1(n=c3(c(=o)[n-]c(=o)n=c(n(cc(o)c(o)c(o)cop([o-])(=o)[o-])c=1c=c(c)2)3))) * inchi-key: *...") |
(Created page with "Category:metabolite == Metabolite Glucose == * common-name: ** glucose == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound == * ...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Glucose == |
* common-name: | * common-name: | ||
− | ** | + | ** glucose |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[3.2.1.1-RXN]] |
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=glucose}} |
− | |||
− |
Revision as of 13:13, 14 January 2021
Contents
Metabolite Glucose
- common-name:
- glucose