Difference between revisions of "3-oxo-cerotoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11877 == * common-name: ** metanephrine * smiles: ** c[n+]cc(o)c1(c=cc(o)=c(oc)c=1) * inchi-key: ** jwjctzkfygdabj-vifpvbqesa-o * mol...") |
(Created page with "Category:metabolite == Metabolite Reduced-cytochromes-c551 == * common-name: ** a reduced cytochrome c551 == Reaction(s) known to consume the compound == * RXN-15838 =...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Reduced-cytochromes-c551 == |
* common-name: | * common-name: | ||
− | ** | + | ** a reduced cytochrome c551 |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-15838]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-15838]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a reduced cytochrome c551}} |
− | |||
− |
Revision as of 13:13, 14 January 2021
Contents
Metabolite Reduced-cytochromes-c551
- common-name:
- a reduced cytochrome c551