Difference between revisions of "ALPHA-GLC-6-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17278 == * common-name: ** a [glycerolipid]-stearidonate == Reaction(s) known to consume the compound == * RXN-11682 * RXN-1604...")
(Created page with "Category:metabolite == Metabolite GLUCONATE == * common-name: ** d-gluconate * smiles: ** c(o)c(o)c(o)c(o)c(o)c(=o)[o-] * inchi-key: ** rghnjxzeokukbd-sqougzdysa-m * molec...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17278 ==
+
== Metabolite GLUCONATE ==
 
* common-name:
 
* common-name:
** a [glycerolipid]-stearidonate
+
** d-gluconate
 +
* smiles:
 +
** c(o)c(o)c(o)c(o)c(o)c(=o)[o-]
 +
* inchi-key:
 +
** rghnjxzeokukbd-sqougzdysa-m
 +
* molecular-weight:
 +
** 195.149
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11682]]
+
* [[GLUCONOKIN-RXN]]
* [[RXN-16041]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16040]]
+
* [[GLUCONATE-5-DEHYDROGENASE-RXN]]
* [[RXN-8347]]
+
* [[GLUCONOLACT-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [glycerolipid]-stearidonate}}
+
{{#set: common-name=d-gluconate}}
 +
{{#set: inchi-key=inchikey=rghnjxzeokukbd-sqougzdysa-m}}
 +
{{#set: molecular-weight=195.149}}

Revision as of 13:13, 14 January 2021

Metabolite GLUCONATE

  • common-name:
    • d-gluconate
  • smiles:
    • c(o)c(o)c(o)c(o)c(o)c(=o)[o-]
  • inchi-key:
    • rghnjxzeokukbd-sqougzdysa-m
  • molecular-weight:
    • 195.149

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality