Difference between revisions of "TRNA-Containing-N2-Methylgua-26-Gua27"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite tRNAPhe-wybutosine == * common-name: ** wybutosine37 in trnaphe == Reaction(s) known to consume the compound == == Reaction(s) known to p...")
(Created page with "Category:metabolite == Metabolite D-MYO-INOSITOL-34-BISPHOSPHATE == * common-name: ** d-myo-inositol (3,4)-bisphosphate * smiles: ** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(op(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite tRNAPhe-wybutosine ==
+
== Metabolite D-MYO-INOSITOL-34-BISPHOSPHATE ==
 
* common-name:
 
* common-name:
** wybutosine37 in trnaphe
+
** d-myo-inositol (3,4)-bisphosphate
 +
* smiles:
 +
** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)1)
 +
* inchi-key:
 +
** mckajxmrulsuki-cnwjwelysa-j
 +
* molecular-weight:
 +
** 336.085
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-10960]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14520]]
+
* [[RXN-10939]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=wybutosine37 in trnaphe}}
+
{{#set: common-name=d-myo-inositol (3,4)-bisphosphate}}
 +
{{#set: inchi-key=inchikey=mckajxmrulsuki-cnwjwelysa-j}}
 +
{{#set: molecular-weight=336.085}}

Revision as of 13:13, 14 January 2021

Metabolite D-MYO-INOSITOL-34-BISPHOSPHATE

  • common-name:
    • d-myo-inositol (3,4)-bisphosphate
  • smiles:
    • c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)1)
  • inchi-key:
    • mckajxmrulsuki-cnwjwelysa-j
  • molecular-weight:
    • 336.085

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality