Difference between revisions of "SJ09819"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite XANTHOSINE == * common-name: ** xanthosine * smiles: ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(=o)nc=23))) * inchi-key: ** ubortcndukbeop-u...") |
(Created page with "Category:gene == Gene SJ09819 == * transcription-direction: ** negative * right-end-position: ** 112158 * left-end-position: ** 97853 * centisome-position: ** 24.133764...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:gene]] |
− | == | + | == Gene SJ09819 == |
− | * | + | * transcription-direction: |
− | ** | + | ** negative |
− | * | + | * right-end-position: |
− | ** | + | ** 112158 |
− | * | + | * left-end-position: |
− | ** | + | ** 97853 |
− | * | + | * centisome-position: |
− | ** | + | ** 24.133764 |
− | == | + | == Organism(s) associated with this gene == |
− | * [[ | + | * [[S.japonica_carotenoid_curated]] |
− | + | == Reaction(s) associated == | |
− | == Reaction(s) | + | * [[3.4.19.12-RXN]] |
− | * [[ | + | ** Category: [[annotation]] |
− | * [[ | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a |
− | + | {{#set: transcription-direction=negative}} | |
− | {{#set: | + | {{#set: right-end-position=112158}} |
− | {{#set: | + | {{#set: left-end-position=97853}} |
− | {{#set: | + | {{#set: centisome-position=24.133764 }} |
+ | {{#set: organism associated=S.japonica_carotenoid_curated}} | ||
+ | {{#set: nb reaction associated=1}} |
Revision as of 18:52, 14 January 2021
Gene SJ09819
- transcription-direction:
- negative
- right-end-position:
- 112158
- left-end-position:
- 97853
- centisome-position:
- 24.133764
Organism(s) associated with this gene
Reaction(s) associated
- 3.4.19.12-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation