Difference between revisions of "CREATINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DIHYDRO-NEO-PTERIN == * common-name: ** 7,8-dihydroneopterin * smiles: ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)co)=2)) * inchi-key: ** yqifam...") |
(Created page with "Category:metabolite == Metabolite G5-pppR-mRNAs == * common-name: ** a 5'-(5'-triphosphoguanosine)-purine-[mrna] == Reaction(s) known to consume the compound == * MRNA-G...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite G5-pppR-mRNAs == |
* common-name: | * common-name: | ||
− | ** | + | ** a 5'-(5'-triphosphoguanosine)-purine-[mrna] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[MRNA-GUANINE-N7--METHYLTRANSFERASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[MRNA-GUANYLYLTRANSFERASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a 5'-(5'-triphosphoguanosine)-purine-[mrna]}} |
− | |||
− |
Revision as of 18:52, 14 January 2021
Contents
Metabolite G5-pppR-mRNAs
- common-name:
- a 5'-(5'-triphosphoguanosine)-purine-[mrna]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a 5'-(5'-triphosphoguanosine)-purine-[mrna" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.