Difference between revisions of "THIOMORPHOLINE-3-CARBOXYLATE"

Revision as of 18:53, 14 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-10712 ==
+== Metabolite MAL ==
 * common-name:
-** di-trans, poly-cis-polyprenyl diphosphate (c80)
+** (s)-malate
 * smiles:
-** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op([o-])(=o)[o-]
+** c(=o)([o-])cc(o)c([o-])=o
 * inchi-key:
-** tunipipdjadhsr-hiqrjctmsa-k
+** bjepykjpyrnkow-reohclbhsa-l
 * molecular-weight:
-** 1264.842
+** 132.073
 == Reaction(s) known to consume the compound ==
+* [[1.1.1.39-RXN]]
+* [[FUMHYDR-RXN]]
+* [[MALATE-DEH-RXN]]
+* [[MALIC-NADP-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-9969]]
+* [[FUMHYDR-RXN]]
+* [[MALATE-DEH-RXN]]
+* [[MALATE-DEHYDROGENASE-NADP+-RXN]]
+* [[MALSYN-RXN]]
+* [[RXN-14937]]
+* [[RXN-6002]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=di-trans, poly-cis-polyprenyl diphosphate (c80)}}
+{{#set: common-name=(s)-malate}}
-{{#set: inchi-key=inchikey=tunipipdjadhsr-hiqrjctmsa-k}}
+{{#set: inchi-key=inchikey=bjepykjpyrnkow-reohclbhsa-l}}
-{{#set: molecular-weight=1264.842}}
+{{#set: molecular-weight=132.073}}