Difference between revisions of "GDP-TP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-7-DIMETHYLXANTHINE == * common-name: ** theobromine * smiles: ** cn2(c=nc1(=c(c(nc(n(c)1)=o)=o)2)) * inchi-key: ** yapqbxqyljrxsa-uhfff...") |
(Created page with "Category:metabolite == Metabolite 16S-rRNA-guanine-527 == * common-name: ** a guanine527 in 16s rrna == Reaction(s) known to consume the compound == * RXN-11578 == Rea...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 16S-rRNA-guanine-527 == |
* common-name: | * common-name: | ||
− | ** | + | ** a guanine527 in 16s rrna |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-11578]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a guanine527 in 16s rrna}} |
− | |||
− |
Revision as of 18:53, 14 January 2021
Contents
Metabolite 16S-rRNA-guanine-527
- common-name:
- a guanine527 in 16s rrna