Difference between revisions of "CPD-10330"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18447 == * common-name: ** actinocin * smiles: ** cc1(=cc=c(c(=o)[o-])c2(n=c3(c(oc1=2)=c(c)c(=o)c(n)=c(c(=o)[o-])3))) * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite CPD-19013 == * common-name: ** 2-methylpropane-1,2-diol * smiles: ** cc(o)(c)co * inchi-key: ** btvwzwfkmiusgs-uhfffaoysa-n * molecular-w...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-19013 == |
* common-name: | * common-name: | ||
− | ** | + | ** 2-methylpropane-1,2-diol |
* smiles: | * smiles: | ||
− | ** | + | ** cc(o)(c)co |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** btvwzwfkmiusgs-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 90.122 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-17589]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=2-methylpropane-1,2-diol}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=btvwzwfkmiusgs-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=90.122}} |
Revision as of 18:53, 14 January 2021
Contents
Metabolite CPD-19013
- common-name:
- 2-methylpropane-1,2-diol
- smiles:
- cc(o)(c)co
- inchi-key:
- btvwzwfkmiusgs-uhfffaoysa-n
- molecular-weight:
- 90.122