Difference between revisions of "Sphingoid-1-phosphates"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 23-DIPHOSPHOGLYCERATE == * common-name: ** 2,3-diphospho-d-glycerate * smiles: ** c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(=o)[o-] * inchi...") |
(Created page with "Category:metabolite == Metabolite OH-ACYL-ACP == * common-name: ** a (3r)-3-hydroxyacyl-[acyl-carrier protein] == Reaction(s) known to consume the compound == * 3-HYDROX...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite OH-ACYL-ACP == |
* common-name: | * common-name: | ||
| − | ** | + | ** a (3r)-3-hydroxyacyl-[acyl-carrier protein] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[3-HYDROXYDECANOYL-ACP-DEHYDR-RXN]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[3-OXOACYL-ACP-REDUCT-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a (3r)-3-hydroxyacyl-[acyl-carrier protein]}} |
| − | |||
| − | |||
Revision as of 18:53, 14 January 2021
Contents
Metabolite OH-ACYL-ACP
- common-name:
- a (3r)-3-hydroxyacyl-[acyl-carrier protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a (3r)-3-hydroxyacyl-[acyl-carrier protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
