Difference between revisions of "5-methylcytosine2870-in-25S-rRNA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12173 == * common-name: ** (s)-3-hydroxy-isobutanoyl-coa * smiles: ** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o...") |
(Created page with "Category:metabolite == Metabolite CPD-11641 == * common-name: ** 4-methylumbelliferyl glucoside * smiles: ** cc3(c2(c=cc(oc1(oc(co)c(o)c(o)c(o)1))=cc=2oc(=o)c=3)) * inchi-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-11641 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-methylumbelliferyl glucoside |
* smiles: | * smiles: | ||
| − | ** | + | ** cc3(c2(c=cc(oc1(oc(co)c(o)c(o)c(o)1))=cc=2oc(=o)c=3)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** yudptgpsbjvhcn-ymiltqatsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 338.313 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-10769]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-methylumbelliferyl glucoside}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yudptgpsbjvhcn-ymiltqatsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=338.313}} |
Revision as of 18:53, 14 January 2021
Contents
Metabolite CPD-11641
- common-name:
- 4-methylumbelliferyl glucoside
- smiles:
- cc3(c2(c=cc(oc1(oc(co)c(o)c(o)c(o)1))=cc=2oc(=o)c=3))
- inchi-key:
- yudptgpsbjvhcn-ymiltqatsa-n
- molecular-weight:
- 338.313
