Difference between revisions of "MG-PROTOPORPHYRIN-MONOMETHYL-ESTER"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite P-NITROPHENOL == * common-name: ** 4-nitrophenol * smiles: ** c1(c=c([o-])c=cc=1[n+](=o)[o-]) * inchi-key: ** btjiuguipkrlhp-uhfffaoysa-m...")
(Created page with "Category:metabolite == Metabolite 2-AMINO-3-3-OXOPROP-2-ENYL-BUT-2-ENEDI == * common-name: ** aminocarboxymuconate semialdehyde * smiles: ** c(=o)([o-])c(=c(c([o-])=o)n)c=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite P-NITROPHENOL ==
+
== Metabolite 2-AMINO-3-3-OXOPROP-2-ENYL-BUT-2-ENEDI ==
 
* common-name:
 
* common-name:
** 4-nitrophenol
+
** aminocarboxymuconate semialdehyde
 
* smiles:
 
* smiles:
** c1(c=c([o-])c=cc=1[n+](=o)[o-])
+
** c(=o)([o-])c(=c(c([o-])=o)n)c=c[ch]=o
 
* inchi-key:
 
* inchi-key:
** btjiuguipkrlhp-uhfffaoysa-m
+
** kacpvqqhdvbvfc-pmrvsphwsa-l
 
* molecular-weight:
 
* molecular-weight:
** 138.102
+
** 183.12
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[AMINO-CARBOXYMUCONATE-SEMIALDEHYDE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
 
* [[ARYLDIALKYL-PHOSPHATASE-RXN]]
 
* [[RXN-17830]]
 
* [[RXN-8743]]
 
* [[RXN-8746]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-nitrophenol}}
+
{{#set: common-name=aminocarboxymuconate semialdehyde}}
{{#set: inchi-key=inchikey=btjiuguipkrlhp-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=kacpvqqhdvbvfc-pmrvsphwsa-l}}
{{#set: molecular-weight=138.102}}
+
{{#set: molecular-weight=183.12}}

Revision as of 18:54, 14 January 2021

Metabolite 2-AMINO-3-3-OXOPROP-2-ENYL-BUT-2-ENEDI

  • common-name:
    • aminocarboxymuconate semialdehyde
  • smiles:
    • c(=o)([o-])c(=c(c([o-])=o)n)c=c[ch]=o
  • inchi-key:
    • kacpvqqhdvbvfc-pmrvsphwsa-l
  • molecular-weight:
    • 183.12

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality