Difference between revisions of "CPD-13612"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-6702 == * common-name: ** 1d-myo-inositol 6-monophosphate * smiles: ** c1(o)(c(o)c(o)c(op([o-])(=o)[o-])c(o)c(o)1) * inchi-key: ** in...") |
(Created page with "Category:metabolite == Metabolite CPD-11673 == * common-name: ** 5-hydroxytryptophol glucuronide * smiles: ** c(o)cc1(=cnc3(=c1c=c(oc2(oc(c(=o)o)c(o)c(o)c(o)2))c=c3)) * in...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-11673 == |
* common-name: | * common-name: | ||
− | ** | + | ** 5-hydroxytryptophol glucuronide |
* smiles: | * smiles: | ||
− | ** | + | ** c(o)cc1(=cnc3(=c1c=c(oc2(oc(c(=o)o)c(o)c(o)c(o)2))c=c3)) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** nflhlwrxdoxscf-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 353.328 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-10784]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=5-hydroxytryptophol glucuronide}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=nflhlwrxdoxscf-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=353.328}} |
Revision as of 18:54, 14 January 2021
Contents
Metabolite CPD-11673
- common-name:
- 5-hydroxytryptophol glucuronide
- smiles:
- c(o)cc1(=cnc3(=c1c=c(oc2(oc(c(=o)o)c(o)c(o)c(o)2))c=c3))
- inchi-key:
- nflhlwrxdoxscf-uhfffaoysa-n
- molecular-weight:
- 353.328