Difference between revisions of "CPD1F-453"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-XYLULOSE == * common-name: ** l-xylulose * smiles: ** c(o)c(o)c(o)c(=o)co * inchi-key: ** zaqjhhrnxzubte-wvzvxsggsa-n * molecular-weigh...")
(Created page with "Category:metabolite == Metabolite CPD-506 == * common-name: ** d-myo-inositol (1,3,4,5)-tetrakisphosphate * smiles: ** c1(o)(c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-XYLULOSE ==
+
== Metabolite CPD-506 ==
 
* common-name:
 
* common-name:
** l-xylulose
+
** d-myo-inositol (1,3,4,5)-tetrakisphosphate
 
* smiles:
 
* smiles:
** c(o)c(o)c(o)c(=o)co
+
** c1(o)(c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)c(op([o-])([o-])=o)1)
 
* inchi-key:
 
* inchi-key:
** zaqjhhrnxzubte-wvzvxsggsa-n
+
** cipfcgzlfxvxbg-cnwjwelysa-f
 
* molecular-weight:
 
* molecular-weight:
** 150.131
+
** 492.013
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[L-XYLULOSE-REDUCTASE-RXN]]
+
* [[RXN-7184]]
 +
* [[RXN-8730]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[L-XYLULOSE-REDUCTASE-RXN]]
+
* [[2.7.1.127-RXN]]
 +
* [[2.7.1.139-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-xylulose}}
+
{{#set: common-name=d-myo-inositol (1,3,4,5)-tetrakisphosphate}}
{{#set: inchi-key=inchikey=zaqjhhrnxzubte-wvzvxsggsa-n}}
+
{{#set: inchi-key=inchikey=cipfcgzlfxvxbg-cnwjwelysa-f}}
{{#set: molecular-weight=150.131}}
+
{{#set: molecular-weight=492.013}}

Revision as of 18:54, 14 January 2021

Metabolite CPD-506

  • common-name:
    • d-myo-inositol (1,3,4,5)-tetrakisphosphate
  • smiles:
    • c1(o)(c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)c(op([o-])([o-])=o)1)
  • inchi-key:
    • cipfcgzlfxvxbg-cnwjwelysa-f
  • molecular-weight:
    • 492.013

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality