Difference between revisions of "Lipoprotein-signal-peptide"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7158 == * common-name: ** 3-demethylubiquinol-9 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cc...")
(Created page with "Category:metabolite == Metabolite ACRYLAMIDE == * common-name: ** acrylamide * smiles: ** c=cc(=o)n * inchi-key: ** hrpvxlwxlxdghg-uhfffaoysa-n * molecular-weight: ** 71.0...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7158 ==
+
== Metabolite ACRYLAMIDE ==
 
* common-name:
 
* common-name:
** 3-demethylubiquinol-9
+
** acrylamide
 
* smiles:
 
* smiles:
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(c)c(o)=c(o)c(oc)=c(o)1)
+
** c=cc(=o)n
 
* inchi-key:
 
* inchi-key:
** alajatogwwbpqt-nscwjznlsa-n
+
** hrpvxlwxlxdghg-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 783.228
+
** 71.079
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.1.1.64-RXN]]
+
* [[R311-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-demethylubiquinol-9}}
+
{{#set: common-name=acrylamide}}
{{#set: inchi-key=inchikey=alajatogwwbpqt-nscwjznlsa-n}}
+
{{#set: inchi-key=inchikey=hrpvxlwxlxdghg-uhfffaoysa-n}}
{{#set: molecular-weight=783.228}}
+
{{#set: molecular-weight=71.079}}

Revision as of 18:54, 14 January 2021

Metabolite ACRYLAMIDE

  • common-name:
    • acrylamide
  • smiles:
    • c=cc(=o)n
  • inchi-key:
    • hrpvxlwxlxdghg-uhfffaoysa-n
  • molecular-weight:
    • 71.079

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality