Difference between revisions of "Core-Protein-L-Ser-Xyl"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-505 == * common-name: ** d-myo-inositol (1,3,4,6)-tetrakisphosphate * smiles: ** c1(o)(c(op([o-])(=o)[o-])c(op([o-])([o-])=o)c(o)c(op...")
(Created page with "Category:metabolite == Metabolite S-Substituted-L-Cysteines == * common-name: ** an l-cysteine-s-conjugate == Reaction(s) known to consume the compound == * RXN-15582...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-505 ==
+
== Metabolite S-Substituted-L-Cysteines ==
 
* common-name:
 
* common-name:
** d-myo-inositol (1,3,4,6)-tetrakisphosphate
+
** an l-cysteine-s-conjugate
* smiles:
 
** c1(o)(c(op([o-])(=o)[o-])c(op([o-])([o-])=o)c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
 
* inchi-key:
 
** zawixngttztbkv-jmvowjsssa-f
 
* molecular-weight:
 
** 492.013
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.1.140-RXN]]
+
* [[RXN-15582]]
 +
* [[RXN-6763]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.1.133-RXN]]
+
* [[RXN-13684]]
 +
* [[RXN-6642]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-myo-inositol (1,3,4,6)-tetrakisphosphate}}
+
{{#set: common-name=an l-cysteine-s-conjugate}}
{{#set: inchi-key=inchikey=zawixngttztbkv-jmvowjsssa-f}}
 
{{#set: molecular-weight=492.013}}
 

Revision as of 18:54, 14 January 2021

Metabolite S-Substituted-L-Cysteines

  • common-name:
    • an l-cysteine-s-conjugate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality