Difference between revisions of "THF-GLU-N"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 5Z13E-15S-9-ALPHA15-DIHYDROXY-11-O == * common-name: ** prostaglandin d2 * smiles: ** cccccc(o)c=cc1(c(=o)cc(o)c(cc=ccccc(=o)[o-])1) * in...") |
(Created page with "Category:metabolite == Metabolite Charged-TYR-tRNAs == * common-name: ** an l-tyrosyl-[trnatyr] == Reaction(s) known to consume the compound == == Reaction(s) known to pro...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Charged-TYR-tRNAs == |
* common-name: | * common-name: | ||
| − | ** | + | ** an l-tyrosyl-[trnatyr] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[TYROSINE--TRNA-LIGASE-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an l-tyrosyl-[trnatyr]}} |
| − | |||
| − | |||
Revision as of 18:54, 14 January 2021
Contents
Metabolite Charged-TYR-tRNAs
- common-name:
- an l-tyrosyl-[trnatyr]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an l-tyrosyl-[trnatyr" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
