Difference between revisions of "CPD-7535"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PHOSPHORIBOSYL-ATP == * common-name: ** 1-(5-phospho-β-d-ribosyl)-atp * smiles: ** c(c4(c(c(c(n3(c(c2(=c(n(c1(c(c(c(o1)cop(op(=o)([o...")
(Created page with "Category:metabolite == Metabolite CPD-12724 == * common-name: ** baicalein * smiles: ** c1(c=cc(=cc=1)c2(=cc(=o)c3(=c(o2)c=c(o)c(o)=c(o)3))) * inchi-key: ** fxnfhkrtjbstcs...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PHOSPHORIBOSYL-ATP ==
+
== Metabolite CPD-12724 ==
 
* common-name:
 
* common-name:
** 1-(5-phospho-β-d-ribosyl)-atp
+
** baicalein
 
* smiles:
 
* smiles:
** c(c4(c(c(c(n3(c(c2(=c(n(c1(c(c(c(o1)cop(op(=o)([o-])op(=o)([o-])o)(=o)[o-])o)o))c=n2)n=c3))=n))o4)o)o))op([o-])([o-])=o
+
** c1(c=cc(=cc=1)c2(=cc(=o)c3(=c(o2)c=c(o)c(o)=c(o)3)))
 
* inchi-key:
 
* inchi-key:
** rknhjbvbfhdxgr-keohhstqsa-i
+
** fxnfhkrtjbstcs-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 714.24
+
** 270.241
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ATPPHOSPHORIBOSYLTRANS-RXN]]
+
* [[RXN-14240]]
* [[HISTPRATPHYD-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ADPART]]
 
* [[ATPPHOSPHORIBOSYLTRANS-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-(5-phospho-β-d-ribosyl)-atp}}
+
{{#set: common-name=baicalein}}
{{#set: inchi-key=inchikey=rknhjbvbfhdxgr-keohhstqsa-i}}
+
{{#set: inchi-key=inchikey=fxnfhkrtjbstcs-uhfffaoysa-n}}
{{#set: molecular-weight=714.24}}
+
{{#set: molecular-weight=270.241}}

Revision as of 18:55, 14 January 2021

Metabolite CPD-12724

  • common-name:
    • baicalein
  • smiles:
    • c1(c=cc(=cc=1)c2(=cc(=o)c3(=c(o2)c=c(o)c(o)=c(o)3)))
  • inchi-key:
    • fxnfhkrtjbstcs-uhfffaoysa-n
  • molecular-weight:
    • 270.241

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality