Difference between revisions of "DEAMIDO-NAD"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15838 == * common-name: ** γ-tocotrienol * smiles: ** cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=cc(=c(c)c=2c)o)))c)c)c * inchi-key: *...") |
(Created page with "Category:metabolite == Metabolite CPD-7630 == * common-name: ** (-)-epicatechin * smiles: ** c3(=c(c2(oc1(=cc(=cc(=c1cc2o)o)o)))c=c(o)c(=c3)o) * inchi-key: ** pftawblqpzve...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-7630 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (-)-epicatechin |
* smiles: | * smiles: | ||
| − | ** | + | ** c3(=c(c2(oc1(=cc(=cc(=c1cc2o)o)o)))c=c(o)c(=c3)o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** pftawblqpzvemu-ukrrqhhqsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 290.272 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-9725]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(-)-epicatechin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pftawblqpzvemu-ukrrqhhqsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=290.272}} |
Revision as of 18:55, 14 January 2021
Contents
Metabolite CPD-7630
- common-name:
- (-)-epicatechin
- smiles:
- c3(=c(c2(oc1(=cc(=cc(=c1cc2o)o)o)))c=c(o)c(=c3)o)
- inchi-key:
- pftawblqpzvemu-ukrrqhhqsa-n
- molecular-weight:
- 290.272
