Difference between revisions of "CPD-5164"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite S-2-Hydroxyacids1 == * common-name: ** an (s)-2-hydroxyacid == Reaction(s) known to consume the compound == * S-2-HYDROXY-ACID-OXIDASE-...")
(Created page with "Category:metabolite == Metabolite DIMP == * common-name: ** dimp * smiles: ** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23))) * inchi-key: ** phngfppxdjjadg-rrkc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite S-2-Hydroxyacids1 ==
+
== Metabolite DIMP ==
 
* common-name:
 
* common-name:
** an (s)-2-hydroxyacid
+
** dimp
 +
* smiles:
 +
** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23)))
 +
* inchi-key:
 +
** phngfppxdjjadg-rrkcrqdmsa-l
 +
* molecular-weight:
 +
** 330.193
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[S-2-HYDROXY-ACID-OXIDASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN0-1602]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an (s)-2-hydroxyacid}}
+
{{#set: common-name=dimp}}
 +
{{#set: inchi-key=inchikey=phngfppxdjjadg-rrkcrqdmsa-l}}
 +
{{#set: molecular-weight=330.193}}

Revision as of 18:55, 14 January 2021

Metabolite DIMP

  • common-name:
    • dimp
  • smiles:
    • c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23)))
  • inchi-key:
    • phngfppxdjjadg-rrkcrqdmsa-l
  • molecular-weight:
    • 330.193

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality