Difference between revisions of "CPD-9451"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite LYS == * common-name: ** l-lysine * smiles: ** c([n+])cccc([n+])c([o-])=o * inchi-key: ** kdxkernsbixsrk-yfkpbyrvsa-o * molecular-weight:...")
(Created page with "Category:metabolite == Metabolite CPD-18762 == * common-name: ** 4-hydroxy-2-methyl-4-[(2e,6e)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]quinolin-3(4h)-one 1-oxide * smiles...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite LYS ==
+
== Metabolite CPD-18762 ==
 
* common-name:
 
* common-name:
** l-lysine
+
** 4-hydroxy-2-methyl-4-[(2e,6e)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]quinolin-3(4h)-one 1-oxide
 
* smiles:
 
* smiles:
** c([n+])cccc([n+])c([o-])=o
+
** cc(c)=cccc(c)=cccc(c)=ccc2(o)(c(c1(c=cc=cc=1[n+](=c(c)2)[o-]))=o)
 
* inchi-key:
 
* inchi-key:
** kdxkernsbixsrk-yfkpbyrvsa-o
+
** hzbjgdkeajeslm-yefhwucqsa-n
 
* molecular-weight:
 
* molecular-weight:
** 147.197
+
** 395.541
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[LYSINE--TRNA-LIGASE-RXN]]
+
* [[RXN-17334]]
* [[LYSINE-N-ACETYLTRANSFERASE-RXN]]
 
* [[RXN-1961]]
 
* [[biomass_rxn]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DIAMINOPIMDECARB-RXN]]
 
* [[LYSINE-N-ACETYLTRANSFERASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-lysine}}
+
{{#set: common-name=4-hydroxy-2-methyl-4-[(2e,6e)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]quinolin-3(4h)-one 1-oxide}}
{{#set: inchi-key=inchikey=kdxkernsbixsrk-yfkpbyrvsa-o}}
+
{{#set: inchi-key=inchikey=hzbjgdkeajeslm-yefhwucqsa-n}}
{{#set: molecular-weight=147.197}}
+
{{#set: molecular-weight=395.541}}

Revision as of 18:55, 14 January 2021

Metabolite CPD-18762

  • common-name:
    • 4-hydroxy-2-methyl-4-[(2e,6e)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]quinolin-3(4h)-one 1-oxide
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=ccc2(o)(c(c1(c=cc=cc=1[n+](=c(c)2)[o-]))=o)
  • inchi-key:
    • hzbjgdkeajeslm-yefhwucqsa-n
  • molecular-weight:
    • 395.541

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "4-hydroxy-2-methyl-4-[(2e,6e)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]quinolin-3(4h)-one 1-oxide" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.