Difference between revisions of "CARBOXYMETHYL-HYDROXYPHENYLPROPCOA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7257 == * common-name: ** 3α,7α,12α-trihydroxy-24-oxo-5-β-cholestanoyl coa * smiles: ** cc(ccc(=o)c(c)c(sccnc(...") |
(Created page with "Category:metabolite == Metabolite CPD-10267 == * common-name: ** decanoyl-coa * smiles: ** cccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-]...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-10267 == |
* common-name: | * common-name: | ||
− | ** | + | ** decanoyl-coa |
* smiles: | * smiles: | ||
− | ** | + | ** cccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** cnkjphsefdpydb-hsjnekgzsa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 917.754 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-13615]] |
+ | * [[RXN-14274]] | ||
+ | * [[RXN-9628]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-13614]] | ||
+ | * [[RXN-14274]] | ||
+ | * [[TRANS-2-ENOYL-COA-REDUCTASE-NAD+-RXN-CPD-10267/NAD//T2-DECENOYL-COA/NADH/PROTON.43.]] | ||
+ | * [[TRANSENOYLCOARED-RXN-CPD-10267/NADP//T2-DECENOYL-COA/NADPH/PROTON.45.]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=decanoyl-coa}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=cnkjphsefdpydb-hsjnekgzsa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=917.754}} |
Revision as of 18:55, 14 January 2021
Contents
Metabolite CPD-10267
- common-name:
- decanoyl-coa
- smiles:
- cccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- cnkjphsefdpydb-hsjnekgzsa-j
- molecular-weight:
- 917.754
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
- RXN-13614
- RXN-14274
- TRANS-2-ENOYL-COA-REDUCTASE-NAD+-RXN-CPD-10267/NAD//T2-DECENOYL-COA/NADH/PROTON.43.
- TRANSENOYLCOARED-RXN-CPD-10267/NADP//T2-DECENOYL-COA/NADPH/PROTON.45.