Difference between revisions of "CPD0-2123"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3725 == * common-name: ** uridine 2'3'-cyclic monophosphate * smiles: ** c1(=cn(c(=o)nc(=o)1)c3(oc(co)c2(op(=o)([o-])oc23))) * inchi-...") |
(Created page with "Category:metabolite == Metabolite eEF-2-Histidines == * common-name: ** an l-histidine-[translation elongation factor 2] == Reaction(s) known to consume the compound == *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite eEF-2-Histidines == |
* common-name: | * common-name: | ||
| − | ** | + | ** an l-histidine-[translation elongation factor 2] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-11371]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an l-histidine-[translation elongation factor 2]}} |
| − | |||
| − | |||
Revision as of 18:56, 14 January 2021
Contents
Metabolite eEF-2-Histidines
- common-name:
- an l-histidine-[translation elongation factor 2]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an l-histidine-[translation elongation factor 2" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
