Difference between revisions of "CPD-14736"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite S-ADENOSYLMETHIONINAMINE == * common-name: ** s-adenosyl 3-(methylthio)propylamine * smiles: ** c[s+](ccc[n+])cc1(oc(c(o)c(o)1)n3(c=nc2(=...")
(Created page with "Category:metabolite == Metabolite THIAMINE == * common-name: ** thiamine * smiles: ** cc1([n+](=csc(cco)=1)cc2(c=nc(c)=nc(n)=2)) * inchi-key: ** jzrwcgzrtzmzeh-uhfffaoysa-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite S-ADENOSYLMETHIONINAMINE ==
+
== Metabolite THIAMINE ==
 
* common-name:
 
* common-name:
** s-adenosyl 3-(methylthio)propylamine
+
** thiamine
 
* smiles:
 
* smiles:
** c[s+](ccc[n+])cc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23)))
+
** cc1([n+](=csc(cco)=1)cc2(c=nc(c)=nc(n)=2))
 
* inchi-key:
 
* inchi-key:
** zunbitixdcpnsd-lsrjevitsa-o
+
** jzrwcgzrtzmzeh-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 356.442
+
** 265.352
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[APAPT]]
+
* [[ExchangeSeed-THIAMINE]]
* [[RXN-11190]]
+
* [[THIAMIN-PYROPHOSPHOKINASE-RXN]]
* [[RXN0-5217]]
+
* [[THIAMINASE-RXN]]
* [[SPERMIDINESYN-RXN]]
+
* [[TransportSeed-THIAMINE]]
* [[SPERMINE-SYNTHASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[AMCL]]
+
* [[ExchangeSeed-THIAMINE]]
* [[RXN-11190]]
+
* [[TransportSeed-THIAMINE]]
* [[SAMDECARB-RXN]]
 
* [[SPERMIDINESYN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=s-adenosyl 3-(methylthio)propylamine}}
+
{{#set: common-name=thiamine}}
{{#set: inchi-key=inchikey=zunbitixdcpnsd-lsrjevitsa-o}}
+
{{#set: inchi-key=inchikey=jzrwcgzrtzmzeh-uhfffaoysa-n}}
{{#set: molecular-weight=356.442}}
+
{{#set: molecular-weight=265.352}}

Revision as of 18:56, 14 January 2021

Metabolite THIAMINE

  • common-name:
    • thiamine
  • smiles:
    • cc1([n+](=csc(cco)=1)cc2(c=nc(c)=nc(n)=2))
  • inchi-key:
    • jzrwcgzrtzmzeh-uhfffaoysa-n
  • molecular-weight:
    • 265.352

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality