Difference between revisions of "DEHYDRO-DEOXY-GALACTONATE-PHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE == * common-name: ** n2-formyl-n1-(5-phospho-β-d-ribosyl)glycinamide * smiles: ** c(nc=o)c(=o)nc1(c...")
(Created page with "Category:metabolite == Metabolite CPD-9067 == * smiles: ** ccc5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)cccc(c)c)c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3=4)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE ==
+
== Metabolite CPD-9067 ==
 +
* smiles:
 +
** ccc5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)cccc(c)c)c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3=4)=cc5=6)))=cc8(=c(c)c(c(c)=o)=c(n78)c=9))))))
 
* common-name:
 
* common-name:
** n2-formyl-n1-(5-phospho-β-d-ribosyl)glycinamide
+
** bacteriochlorophyll a
* smiles:
 
** c(nc=o)c(=o)nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1)
 
* inchi-key:
 
** vdxlundmvkskho-xvfcmesisa-l
 
 
* molecular-weight:
 
* molecular-weight:
** 312.172
+
** 910.51
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[FGAMSYN-RXN]]
+
* [[RXN-8791]]
* [[FGFTh]]
 
* [[FPGFTh]]
 
* [[GART-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[FPGFTh]]
+
* [[RXN-17426]]
* [[GART-RXN]]
+
* [[RXN-8791]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n2-formyl-n1-(5-phospho-β-d-ribosyl)glycinamide}}
+
{{#set: common-name=bacteriochlorophyll a}}
{{#set: inchi-key=inchikey=vdxlundmvkskho-xvfcmesisa-l}}
+
{{#set: molecular-weight=910.51}}
{{#set: molecular-weight=312.172}}
 

Revision as of 18:56, 14 January 2021

Metabolite CPD-9067

  • smiles:
    • ccc5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)cccc(c)c)c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3=4)=cc5=6)))=cc8(=c(c)c(c(c)=o)=c(n78)c=9))))))
  • common-name:
    • bacteriochlorophyll a
  • molecular-weight:
    • 910.51

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality