Difference between revisions of "CPD-11712"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite SQUALENE == * common-name: ** squalene * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc=c(c)ccc=c(c)ccc=c(c)c * inchi-key: ** yygntywphwgjrm-aajyl...") |
(Created page with "Category:metabolite == Metabolite VibB == * common-name: ** an apo-[vibb aryl-carrier protein] == Reaction(s) known to consume the compound == * RXN-10994 == Reaction(...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite VibB == |
* common-name: | * common-name: | ||
− | ** | + | ** an apo-[vibb aryl-carrier protein] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-10994]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-10994]] |
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an apo-[vibb aryl-carrier protein]}} |
− | |||
− |
Revision as of 18:57, 14 January 2021
Contents
Metabolite VibB
- common-name:
- an apo-[vibb aryl-carrier protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an apo-[vibb aryl-carrier protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.