Difference between revisions of "Initiation-tRNAmet"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ALLANTOATE == * common-name: ** allantoate * smiles: ** c(c(=o)[o-])(nc(=o)n)nc(=o)n * inchi-key: ** nucljnswzchrkl-uhfffaoysa-m * molecu...") |
(Created page with "Category:metabolite == Metabolite Detyrosinated-alpha--tubulins == * common-name: ** detyrosinated α-tubulin == Reaction(s) known to consume the compound == * 6.3....") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Detyrosinated-alpha--tubulins == |
* common-name: | * common-name: | ||
− | ** | + | ** detyrosinated α-tubulin |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[6.3.2.25-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=detyrosinated α-tubulin}} |
− | |||
− |
Revision as of 18:57, 14 January 2021
Contents
Metabolite Detyrosinated-alpha--tubulins
- common-name:
- detyrosinated α-tubulin