Difference between revisions of "CPD-190"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11403 == * common-name: ** tetraiodothyroacetate * smiles: ** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c(i)=c2)) * inchi-key: *...") |
(Created page with "Category:metabolite == Metabolite S-Substituted-Glutathione == * common-name: ** a glutathione-toxin conjugate == Reaction(s) known to consume the compound == * RXN-6641...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite S-Substituted-Glutathione == |
* common-name: | * common-name: | ||
− | ** | + | ** a glutathione-toxin conjugate |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-6641]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[GSHTRAN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a glutathione-toxin conjugate}} |
− | |||
− |
Revision as of 18:57, 14 January 2021
Contents
Metabolite S-Substituted-Glutathione
- common-name:
- a glutathione-toxin conjugate