Difference between revisions of "CPD-11602"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17373 == * common-name: ** 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate * smiles: ** c(o)cccccccc=ccccccccc(oc...")
(Created page with "Category:metabolite == Metabolite Ribonucleoside-Monophosphates == * common-name: ** a ribonucleoside 5'-monophosphate == Reaction(s) known to consume the compound == * ...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17373 ==
+
== Metabolite Ribonucleoside-Monophosphates ==
 
* common-name:
 
* common-name:
** 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate
+
** a ribonucleoside 5'-monophosphate
* smiles:
 
** c(o)cccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccco)cop([o-])(=o)[o-])=o
 
* inchi-key:
 
** zxbgeihfxphrjy-nkfdzxfusa-l
 
* molecular-weight:
 
** 728.942
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16121]]
+
* [[5-NUCLEOTID-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16118]]
+
* [[RXN0-4222]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate}}
+
{{#set: common-name=a ribonucleoside 5'-monophosphate}}
{{#set: inchi-key=inchikey=zxbgeihfxphrjy-nkfdzxfusa-l}}
 
{{#set: molecular-weight=728.942}}
 

Revision as of 18:57, 14 January 2021

Metabolite Ribonucleoside-Monophosphates

  • common-name:
    • a ribonucleoside 5'-monophosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality