Difference between revisions of "CPD-14893"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-1-GLYCERO-PHOSPHORYLCHOLINE == * common-name: ** sn-glycero-3-phosphocholine * smiles: ** c([n+](c)(c)c)cop([o-])(=o)occ(o)co * inchi-k...") |
(Created page with "Category:metabolite == Metabolite CPD-14893 == * common-name: ** ergost-7-enol * smiles: ** cc(c)c(c)ccc(c)[ch]3(cc[ch]4(c2(=cc[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34)))) * inchi-...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-14893 == |
* common-name: | * common-name: | ||
| − | ** | + | ** ergost-7-enol |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c)c(c)ccc(c)[ch]3(cc[ch]4(c2(=cc[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34)))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** pugbzuwutzuucp-zrkhgvcbsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 400.687 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-13883]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=ergost-7-enol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pugbzuwutzuucp-zrkhgvcbsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=400.687}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-14893
- common-name:
- ergost-7-enol
- smiles:
- cc(c)c(c)ccc(c)[ch]3(cc[ch]4(c2(=cc[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34))))
- inchi-key:
- pugbzuwutzuucp-zrkhgvcbsa-n
- molecular-weight:
- 400.687
