Difference between revisions of "CD-SP-2Fe2S-Complex"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3707 == * common-name: ** adenosine 2',3'-cyclic monophosphate * smiles: ** c4(n=c3(n(c1(c2(c(c(o1)co)op(o2)([o-])=o)))c=nc3=c(n=4)n)...")
(Created page with "Category:metabolite == Metabolite CD-SP-2Fe2S-Complex == * common-name: ** a [cysteine desulfurase]-[scaffold protein-(2fe-2s)] complex == Reaction(s) known to consume the...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-3707 ==
+
== Metabolite CD-SP-2Fe2S-Complex ==
 
* common-name:
 
* common-name:
** adenosine 2',3'-cyclic monophosphate
+
** a [cysteine desulfurase]-[scaffold protein-(2fe-2s)] complex
* smiles:
 
** c4(n=c3(n(c1(c2(c(c(o1)co)op(o2)([o-])=o)))c=nc3=c(n=4)n))
 
* inchi-key:
 
** kmywvddipvnlme-kqynxxcusa-m
 
* molecular-weight:
 
** 328.201
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12057]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-14387]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=adenosine 2',3'-cyclic monophosphate}}
+
{{#set: common-name=a [cysteine desulfurase]-[scaffold protein-(2fe-2s)] complex}}
{{#set: inchi-key=inchikey=kmywvddipvnlme-kqynxxcusa-m}}
 
{{#set: molecular-weight=328.201}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CD-SP-2Fe2S-Complex

  • common-name:
    • a [cysteine desulfurase]-[scaffold protein-(2fe-2s)] complex

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [cysteine desulfurase]-[scaffold protein-(2fe-2s)] complex" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.