Difference between revisions of "CPD-15279"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-2-N-linked-Glycan == * common-name: ** man3glcnac4-[protein] == Reaction(s) known to consume the compound == * 2.4.1.145-RXN * 2....")
(Created page with "Category:metabolite == Metabolite CPD-15279 == * common-name: ** γ-l-glutamyl-s-(hercyn-2-yl)-l-cysteine s-oxide * smiles: ** c[n+](c(c(=o)[o-])cc1(=cnc(s(=o)cc(c([o...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-2-N-linked-Glycan ==
+
== Metabolite CPD-15279 ==
 
* common-name:
 
* common-name:
** man3glcnac4-[protein]
+
** γ-l-glutamyl-s-(hercyn-2-yl)-l-cysteine s-oxide
 +
* smiles:
 +
** c[n+](c(c(=o)[o-])cc1(=cnc(s(=o)cc(c([o-])=o)nc(=o)ccc([n+])c(=o)[o-])=n1))(c)c
 +
* inchi-key:
 +
** sjhlsluuwibqns-tylceogasa-m
 +
* molecular-weight:
 +
** 460.481
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.4.1.145-RXN]]
 
* [[2.4.1.68-RXN]]
 
* [[2.4.2.38-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-14430]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=man3glcnac4-[protein]}}
+
{{#set: common-name=γ-l-glutamyl-s-(hercyn-2-yl)-l-cysteine s-oxide}}
 +
{{#set: inchi-key=inchikey=sjhlsluuwibqns-tylceogasa-m}}
 +
{{#set: molecular-weight=460.481}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-15279

  • common-name:
    • γ-l-glutamyl-s-(hercyn-2-yl)-l-cysteine s-oxide
  • smiles:
    • c[n+](c(c(=o)[o-])cc1(=cnc(s(=o)cc(c([o-])=o)nc(=o)ccc([n+])c(=o)[o-])=n1))(c)c
  • inchi-key:
    • sjhlsluuwibqns-tylceogasa-m
  • molecular-weight:
    • 460.481

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality