Difference between revisions of "CPD-85"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17346 == * common-name: ** 3-oxo-(11z,14z)-icosa-11,14-dienoyl-coa * smiles: ** cccccc=ccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(...")
(Created page with "Category:metabolite == Metabolite CPD-85 == * common-name: ** 1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one * smiles: ** csccc(c([o-])=co)=o * inchi-key: ** cilxjjlqptuu...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17346 ==
+
== Metabolite CPD-85 ==
 
* common-name:
 
* common-name:
** 3-oxo-(11z,14z)-icosa-11,14-dienoyl-coa
+
** 1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one
 
* smiles:
 
* smiles:
** cccccc=ccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** csccc(c([o-])=co)=o
 
* inchi-key:
 
* inchi-key:
** puwduocpcwfefg-ygyqdceasa-j
+
** cilxjjlqptuuss-xqrvvysfsa-m
 
* molecular-weight:
 
* molecular-weight:
** 1067.974
+
** 161.195
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16095]]
+
* [[R147-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16094]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-(11z,14z)-icosa-11,14-dienoyl-coa}}
+
{{#set: common-name=1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one}}
{{#set: inchi-key=inchikey=puwduocpcwfefg-ygyqdceasa-j}}
+
{{#set: inchi-key=inchikey=cilxjjlqptuuss-xqrvvysfsa-m}}
{{#set: molecular-weight=1067.974}}
+
{{#set: molecular-weight=161.195}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-85

  • common-name:
    • 1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one
  • smiles:
    • csccc(c([o-])=co)=o
  • inchi-key:
    • cilxjjlqptuuss-xqrvvysfsa-m
  • molecular-weight:
    • 161.195

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality