Difference between revisions of "RNASE-II-POLY-A-SUBSTRATE-MRNA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite P3I == * common-name: ** pppi * smiles: ** [o-]p(op(=o)(op([o-])(=o)[o-])[o-])([o-])=o * inchi-key: ** unxrwkveancorm-uhfffaoysa-i * mole...")
(Created page with "Category:metabolite == Metabolite RNASE-II-POLY-A-SUBSTRATE-MRNA == * common-name: ** rnase ii poly-a substrate mrna == Reaction(s) known to consume the compound == * RX...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite P3I ==
+
== Metabolite RNASE-II-POLY-A-SUBSTRATE-MRNA ==
 
* common-name:
 
* common-name:
** pppi
+
** rnase ii poly-a substrate mrna
* smiles:
 
** [o-]p(op(=o)(op([o-])(=o)[o-])[o-])([o-])=o
 
* inchi-key:
 
** unxrwkveancorm-uhfffaoysa-i
 
* molecular-weight:
 
** 252.915
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[TRIPHOSPHATASE-RXN]]
+
* [[RXN0-6524]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[4.2.3.12-RXN]]
 
* [[BTUR2-RXN]]
 
* [[COBALADENOSYLTRANS-RXN]]
 
* [[DGTPTRIPHYDRO-RXN]]
 
* [[R344-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pppi}}
+
{{#set: common-name=rnase ii poly-a substrate mrna}}
{{#set: inchi-key=inchikey=unxrwkveancorm-uhfffaoysa-i}}
 
{{#set: molecular-weight=252.915}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite RNASE-II-POLY-A-SUBSTRATE-MRNA

  • common-name:
    • rnase ii poly-a substrate mrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality