Difference between revisions of "25S-rRNA-adenine-2142"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-465 == * common-name: ** presqualene diphosphate * smiles: ** cc(=cccc(=cccc(=cc1(c(c)(ccc=c(ccc=c(c)c)c)c1cop(op([o-])([o-])=o)([o-]...")
(Created page with "Category:metabolite == Metabolite 25S-rRNA-adenine-2142 == * common-name: ** adenine2142 in 25s rrna == Reaction(s) known to consume the compound == * RXN-14549 == Rea...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-465 ==
+
== Metabolite 25S-rRNA-adenine-2142 ==
 
* common-name:
 
* common-name:
** presqualene diphosphate
+
** adenine2142 in 25s rrna
* smiles:
 
** cc(=cccc(=cccc(=cc1(c(c)(ccc=c(ccc=c(c)c)c)c1cop(op([o-])([o-])=o)([o-])=o))c)c)c
 
* inchi-key:
 
** atzkauggnmsccy-qlydttawsa-k
 
* molecular-weight:
 
** 583.66
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13724]]
+
* [[RXN-14549]]
* [[RXN66-281]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12263]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=presqualene diphosphate}}
+
{{#set: common-name=adenine2142 in 25s rrna}}
{{#set: inchi-key=inchikey=atzkauggnmsccy-qlydttawsa-k}}
 
{{#set: molecular-weight=583.66}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite 25S-rRNA-adenine-2142

  • common-name:
    • adenine2142 in 25s rrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality