Difference between revisions of "ALPHA-GLC-6-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10809 == * common-name: ** 2,5-diamino-6-(5-phospho-d-ribitylamino)pyrimidin-4(3h)-one * smiles: ** c(nc1(n=c(nc(=o)c(n)=1)n))c(o)c(o...")
(Created page with "Category:metabolite == Metabolite ALPHA-GLC-6-P == * common-name: ** α-d-glucose 6-phosphate * smiles: ** c(op(=o)([o-])[o-])c1(oc(o)c(o)c(o)c(o)1) * inchi-key: ** n...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-10809 ==
+
== Metabolite ALPHA-GLC-6-P ==
 
* common-name:
 
* common-name:
** 2,5-diamino-6-(5-phospho-d-ribitylamino)pyrimidin-4(3h)-one
+
** α-d-glucose 6-phosphate
 
* smiles:
 
* smiles:
** c(nc1(n=c(nc(=o)c(n)=1)n))c(o)c(o)c(o)cop([o-])(=o)[o-]
+
** c(op(=o)([o-])[o-])c1(oc(o)c(o)c(o)c(o)1)
 
* inchi-key:
 
* inchi-key:
** acivvgbvovhfpq-rpdrrwsusa-l
+
** nbschqhzlsjfnq-dvkngefbsa-l
 
* molecular-weight:
 
* molecular-weight:
** 353.228
+
** 258.121
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14171]]
+
* [[G6PADH]]
 +
* [[G6PADHh]]
 +
* [[G6PI]]
 +
* [[GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN]]
 +
* [[PGCM]]
 +
* [[PGIA]]
 +
* [[PGIAh]]
 +
* [[PGMTh]]
 +
* [[RXN-15312]]
 +
* [[UG6PGT]]
 +
* [[UG6PGTn]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10057]]
+
* [[G6PI]]
* [[RXN-14171]]
+
* [[GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN]]
 +
* [[PGCM]]
 +
* [[PGIA]]
 +
* [[PGIAh]]
 +
* [[PGMTh]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2,5-diamino-6-(5-phospho-d-ribitylamino)pyrimidin-4(3h)-one}}
+
{{#set: common-name=α-d-glucose 6-phosphate}}
{{#set: inchi-key=inchikey=acivvgbvovhfpq-rpdrrwsusa-l}}
+
{{#set: inchi-key=inchikey=nbschqhzlsjfnq-dvkngefbsa-l}}
{{#set: molecular-weight=353.228}}
+
{{#set: molecular-weight=258.121}}

Latest revision as of 11:17, 18 March 2021

Metabolite ALPHA-GLC-6-P

  • common-name:
    • α-d-glucose 6-phosphate
  • smiles:
    • c(op(=o)([o-])[o-])c1(oc(o)c(o)c(o)c(o)1)
  • inchi-key:
    • nbschqhzlsjfnq-dvkngefbsa-l
  • molecular-weight:
    • 258.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality