Difference between revisions of "PWY-7917"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10608 CPD-10608] ==
+== Pathway PWY-7917 ==
+* taxonomic-range:
+** tax-2759
 * common-name:
-** trans-dienelactone
+** pheomelanin biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c1(=cc(=o)oc(=cc(=o)[o-])1)
+* [[MONOPHENOL-MONOOXYGENASE-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** ayfxpgxazmfwnh-onegzznksa-m
+* [NoneRXN-18894 RXN-18894]
-* molecular-weight:
+* [NoneRXN-18896 RXN-18896]
-** 139.087
+* [NoneRXN-18898 RXN-18898]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-18897 RXN-18897]
-* [[RXN-9868]]
+* [NoneRXN-18899 RXN-18899]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-18895 RXN-18895]
-== Reaction(s) of unknown directionality ==
+* [NoneRXN-14185 RXN-14185]
-{{#set: common-name=trans-dienelactone}}
+{{#set: taxonomic-range=tax-2759}}
-{{#set: inchi-key=inchikey=ayfxpgxazmfwnh-onegzznksa-m}}
+{{#set: common-name=pheomelanin biosynthesis}}
-{{#set: molecular-weight=139.087}}
+{{#set: nb reaction found=1}}
+{{#set: completion rate=0.12}}
+{{#set: nb total reaction=8}}