Difference between revisions of "CPD0-2472"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15637 == * common-name: ** 6-cis-tridecenoyl-coa * smiles: ** ccccccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op(...")
(Created page with "Category:metabolite == Metabolite CPD0-2472 == * common-name: ** (r)-nadhx * smiles: ** c1(=c(ccc(o)n1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15637 ==
+
== Metabolite CPD0-2472 ==
 
* common-name:
 
* common-name:
** 6-cis-tridecenoyl-coa
+
** (r)-nadhx
 
* smiles:
 
* smiles:
** ccccccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c1(=c(ccc(o)n1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34))))c(o)c(o)5))c(n)=o)
 
* inchi-key:
 
* inchi-key:
** uuivzebypbpkll-dxazuofzsa-j
+
** idbzkgqrlbfufq-mtkbybfrsa-l
 
* molecular-weight:
 
* molecular-weight:
** 957.819
+
** 681.445
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14771]]
+
* [[RXN-12752]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6-cis-tridecenoyl-coa}}
+
{{#set: common-name=(r)-nadhx}}
{{#set: inchi-key=inchikey=uuivzebypbpkll-dxazuofzsa-j}}
+
{{#set: inchi-key=inchikey=idbzkgqrlbfufq-mtkbybfrsa-l}}
{{#set: molecular-weight=957.819}}
+
{{#set: molecular-weight=681.445}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD0-2472

  • common-name:
    • (r)-nadhx
  • smiles:
    • c1(=c(ccc(o)n1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34))))c(o)c(o)5))c(n)=o)
  • inchi-key:
    • idbzkgqrlbfufq-mtkbybfrsa-l
  • molecular-weight:
    • 681.445

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality