Difference between revisions of "CPD0-2472"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15637 == * common-name: ** 6-cis-tridecenoyl-coa * smiles: ** ccccccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op(...") |
(Created page with "Category:metabolite == Metabolite CPD0-2472 == * common-name: ** (r)-nadhx * smiles: ** c1(=c(ccc(o)n1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD0-2472 == |
* common-name: | * common-name: | ||
− | ** | + | ** (r)-nadhx |
* smiles: | * smiles: | ||
− | ** | + | ** c1(=c(ccc(o)n1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34))))c(o)c(o)5))c(n)=o) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** idbzkgqrlbfufq-mtkbybfrsa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 681.445 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-12752]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(r)-nadhx}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=idbzkgqrlbfufq-mtkbybfrsa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=681.445}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD0-2472
- common-name:
- (r)-nadhx
- smiles:
- c1(=c(ccc(o)n1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34))))c(o)c(o)5))c(n)=o)
- inchi-key:
- idbzkgqrlbfufq-mtkbybfrsa-l
- molecular-weight:
- 681.445