Difference between revisions of "CPD-8625"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-341 == * common-name: ** indole-3-ethanol * smiles: ** c2(=c(cco)c1(c=cc=cc=1n2)) * inchi-key: ** mbbomcvgycrmea-uhfffaoysa-n * molec...") |
(Created page with "Category:metabolite == Metabolite CPD-8625 == * common-name: ** a [protein]-l-proline (ω = 0) == Reaction(s) known to consume the compound == * PEPTIDYLPROLYL-ISOM...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-8625 == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [protein]-l-proline (ω = 0) |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[PEPTIDYLPROLYL-ISOMERASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[PEPTIDYLPROLYL-ISOMERASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [protein]-l-proline (ω = 0)}} |
| − | |||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-8625
- common-name:
- a [protein]-l-proline (ω = 0)
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [protein]-l-proline (ω = 0)" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
