Difference between revisions of "CPD-341"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite cis-vaccen-2-enoyl-ACPs == * common-name: ** a (2-trans-11-cis)-vaccen-2-enoyl-[acp] == Reaction(s) known to consume the compound == * ...")
(Created page with "Category:metabolite == Metabolite CPD-341 == * common-name: ** indole-3-ethanol * smiles: ** c2(=c(cco)c1(c=cc=cc=1n2)) * inchi-key: ** mbbomcvgycrmea-uhfffaoysa-n * molec...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite cis-vaccen-2-enoyl-ACPs ==
+
== Metabolite CPD-341 ==
 
* common-name:
 
* common-name:
** a (2-trans-11-cis)-vaccen-2-enoyl-[acp]
+
** indole-3-ethanol
 +
* smiles:
 +
** c2(=c(cco)c1(c=cc=cc=1n2))
 +
* inchi-key:
 +
** mbbomcvgycrmea-uhfffaoysa-n
 +
* molecular-weight:
 +
** 161.203
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9558]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9557]]
+
* [[RXN-10717]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a (2-trans-11-cis)-vaccen-2-enoyl-[acp]}}
+
{{#set: common-name=indole-3-ethanol}}
 +
{{#set: inchi-key=inchikey=mbbomcvgycrmea-uhfffaoysa-n}}
 +
{{#set: molecular-weight=161.203}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-341

  • common-name:
    • indole-3-ethanol
  • smiles:
    • c2(=c(cco)c1(c=cc=cc=1n2))
  • inchi-key:
    • mbbomcvgycrmea-uhfffaoysa-n
  • molecular-weight:
    • 161.203

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality